C25H23F3N2O2 — CID 29260743
[4-(2-methoxyphenyl)piperazin-1-yl]-[2-[4-(trifluoromethyl)phenyl]phenyl]methanone (PubChem CID 29260743) has the molecular formula C25H23F3N2O2 and a molecular weight of 440.47 g/mol. Its IUPAC name is [4-(2-methoxyphenyl)piperazin-1-yl]-[2-[4-(trifluoromethyl)phenyl]phenyl]methanone.
| Compound Name | [4-(2-methoxyphenyl)piperazin-1-yl]-[2-[4-(trifluoromethyl)phenyl]phenyl]methanone |
|---|---|
| PubChem CID | 29260743 |
| Molecular Formula | C25H23F3N2O2 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | [4-(2-methoxyphenyl)piperazin-1-yl]-[2-[4-(trifluoromethyl)phenyl]phenyl]methanone |
| SMILES | COc1ccccc1N1CCN(C(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C25H23F3N2O2/c1-32-23-9-5-4-8-22(23)29-14-16-30(17-15-29)24(31)21-7-3-2-6-20(21)18-10-12-19(13-11-18)25(26,27)28/h2-13H,14-17H2,1H3 |
| InChIKey | RWYISMDMJICDTC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |