C23H20F6N2O3S — CID 87599438
(2E)-N-(1,1-dioxo-1,4-thiazinan-4-yl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 87599438) has the molecular formula C23H20F6N2O3S and a molecular weight of 518.48 g/mol. Its IUPAC name is (2E)-N-(1,1-dioxo-1,4-thiazinan-4-yl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | (2E)-N-(1,1-dioxo-1,4-thiazinan-4-yl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 87599438 |
| Molecular Formula | C23H20F6N2O3S |
| Molecular Weight | 518.48 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | (2E)-N-(1,1-dioxo-1,4-thiazinan-4-yl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | O=C(/C=C/C=C(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)NN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C23H20F6N2O3S/c24-22(25,26)18-8-4-16(5-9-18)20(17-6-10-19(11-7-17)23(27,28)29)2-1-3-21(32)30-31-12-14-35(33,34)15-13-31/h1-11H,12-15H2,(H,30,32)/b3-1+ |
| InChIKey | HFDWFAWTEKSVKS-HNQUOIGGSA-N |
| XLogP | 4.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|