C25H18F6N2O2 — CID 87621446
(2E)-N-(6-hydroxyiminocyclohexa-1,3-dien-1-yl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 87621446) has the molecular formula C25H18F6N2O2 and a molecular weight of 492.42 g/mol. Its IUPAC name is (2E)-N-(6-hydroxyiminocyclohexa-1,3-dien-1-yl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | (2E)-N-(6-hydroxyiminocyclohexa-1,3-dien-1-yl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 87621446 |
| Molecular Formula | C25H18F6N2O2 |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | (2E)-N-(6-hydroxyiminocyclohexa-1,3-dien-1-yl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | O=C(/C=C/C=C(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)NC1=CC=CCC1=NO |
| InChI | InChI=1S/C25H18F6N2O2/c26-24(27,28)18-12-8-16(9-13-18)20(17-10-14-19(15-11-17)25(29,30)31)4-3-7-23(34)32-21-5-1-2-6-22(21)33-35/h1-5,7-15,35H,6H2,(H,32,34)/b7-3+,33-22? |
| InChIKey | GQLMLPHCGCLZDZ-VXQLPFRFSA-N |
| XLogP | 6.50 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|