C26H20F6N2O3 — CID 91490722
N-[4-(hydroxyamino)-3-methoxyphenyl]-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 91490722) has the molecular formula C26H20F6N2O3 and a molecular weight of 522.45 g/mol. Its IUPAC name is N-[4-(hydroxyamino)-3-methoxyphenyl]-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | N-[4-(hydroxyamino)-3-methoxyphenyl]-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 91490722 |
| Molecular Formula | C26H20F6N2O3 |
| Molecular Weight | 522.45 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | N-[4-(hydroxyamino)-3-methoxyphenyl]-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | COc1cc(NC(=O)C=CC=C(c2ccc(C(F)(F)F)cc2)c2ccc(C(F)(F)F)cc2)ccc1NO |
| InChI | InChI=1S/C26H20F6N2O3/c1-37-23-15-20(13-14-22(23)34-36)33-24(35)4-2-3-21(16-5-9-18(10-6-16)25(27,28)29)17-7-11-19(12-8-17)26(30,31)32/h2-15,34,36H,1H3,(H,33,35) |
| InChIKey | HPFSPHDCWUXMJF-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.45 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|