C26H23F3N2O2 — CID 87598047
(2E,4Z)-N-(3-aminophenyl)-5-(4-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 87598047) has the molecular formula C26H23F3N2O2 and a molecular weight of 452.48 g/mol. Its IUPAC name is (2E,4Z)-N-(3-aminophenyl)-5-(4-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | (2E,4Z)-N-(3-aminophenyl)-5-(4-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 87598047 |
| Molecular Formula | C26H23F3N2O2 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | (2E,4Z)-N-(3-aminophenyl)-5-(4-ethoxyphenyl)-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | CCOc1ccc(/C(=C\C=C\C(=O)Nc2cccc(N)c2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C26H23F3N2O2/c1-2-33-23-15-11-19(12-16-23)24(18-9-13-20(14-10-18)26(27,28)29)7-4-8-25(32)31-22-6-3-5-21(30)17-22/h3-17H,2,30H2,1H3,(H,31,32)/b8-4+,24-7- |
| InChIKey | XFIBEUAGPQRZNP-SFZHHPOKSA-N |
| XLogP | 6.31 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|