C29H24F3N3O2 — CID 87598148
(2E,4Z)-5-[4-(2-aminoethoxy)phenyl]-N-isoquinolin-5-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 87598148) has the molecular formula C29H24F3N3O2 and a molecular weight of 503.52 g/mol. Its IUPAC name is (2E,4Z)-5-[4-(2-aminoethoxy)phenyl]-N-isoquinolin-5-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | (2E,4Z)-5-[4-(2-aminoethoxy)phenyl]-N-isoquinolin-5-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 87598148 |
| Molecular Formula | C29H24F3N3O2 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | (2E,4Z)-5-[4-(2-aminoethoxy)phenyl]-N-isoquinolin-5-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | NCCOc1ccc(/C(=C\C=C\C(=O)Nc2cccc3cnccc23)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C29H24F3N3O2/c30-29(31,32)23-11-7-20(8-12-23)25(21-9-13-24(14-10-21)37-18-16-33)4-2-6-28(36)35-27-5-1-3-22-19-34-17-15-26(22)27/h1-15,17,19H,16,18,33H2,(H,35,36)/b6-2+,25-4- |
| InChIKey | MIHKVGHAHBAKCN-ANPLUSDQSA-N |
| XLogP | 6.22 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|