C28H18N4O — CID 91311613
5,5-bis(4-cyanophenyl)-N-isoquinolin-5-ylpenta-2,4-dienamide (PubChem CID 91311613) has the molecular formula C28H18N4O and a molecular weight of 426.48 g/mol. Its IUPAC name is 5,5-bis(4-cyanophenyl)-N-isoquinolin-5-ylpenta-2,4-dienamide.
| Compound Name | 5,5-bis(4-cyanophenyl)-N-isoquinolin-5-ylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 91311613 |
| Molecular Formula | C28H18N4O |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 5,5-bis(4-cyanophenyl)-N-isoquinolin-5-ylpenta-2,4-dienamide |
| SMILES | N#Cc1ccc(C(=CC=CC(=O)Nc2cccc3cnccc23)c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C28H18N4O/c29-17-20-7-11-22(12-8-20)25(23-13-9-21(18-30)10-14-23)4-2-6-28(33)32-27-5-1-3-24-19-31-16-15-26(24)27/h1-16,19H,(H,32,33) |
| InChIKey | LHJDZOHLMRAWSG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|