C26H18N4O5 — CID 87599291
(2E)-N-isoquinolin-5-yl-5,5-bis(3-nitrophenyl)penta-2,4-dienamide (PubChem CID 87599291) has the molecular formula C26H18N4O5 and a molecular weight of 466.45 g/mol. Its IUPAC name is (2E)-N-isoquinolin-5-yl-5,5-bis(3-nitrophenyl)penta-2,4-dienamide.
| Compound Name | (2E)-N-isoquinolin-5-yl-5,5-bis(3-nitrophenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 87599291 |
| Molecular Formula | C26H18N4O5 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | (2E)-N-isoquinolin-5-yl-5,5-bis(3-nitrophenyl)penta-2,4-dienamide |
| SMILES | O=C(/C=C/C=C(c1cccc([N+](=O)[O-])c1)c1cccc([N+](=O)[O-])c1)Nc1cccc2cnccc12 |
| InChI | InChI=1S/C26H18N4O5/c31-26(28-25-11-3-7-20-17-27-14-13-24(20)25)12-4-10-23(18-5-1-8-21(15-18)29(32)33)19-6-2-9-22(16-19)30(34)35/h1-17H,(H,28,31)/b12-4+ |
| InChIKey | FAWGSPVBLIZLJO-UUILKARUSA-N |
| XLogP | 5.68 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|