C30H25F3N2O2 — CID 86633267
(2E,4E)-5-[4-(2-hydroxypropan-2-yl)phenyl]-N-isoquinolin-5-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 86633267) has the molecular formula C30H25F3N2O2 and a molecular weight of 502.54 g/mol. Its IUPAC name is (2E,4E)-5-[4-(2-hydroxypropan-2-yl)phenyl]-N-isoquinolin-5-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | (2E,4E)-5-[4-(2-hydroxypropan-2-yl)phenyl]-N-isoquinolin-5-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 86633267 |
| Molecular Formula | C30H25F3N2O2 |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | (2E,4E)-5-[4-(2-hydroxypropan-2-yl)phenyl]-N-isoquinolin-5-yl-5-[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | CC(C)(O)c1ccc(/C(=C\C=C\C(=O)Nc2cccc3cnccc23)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H25F3N2O2/c1-29(2,37)23-13-9-20(10-14-23)25(21-11-15-24(16-12-21)30(31,32)33)6-4-8-28(36)35-27-7-3-5-22-19-34-18-17-26(22)27/h3-19,37H,1-2H3,(H,35,36)/b8-4+,25-6+ |
| InChIKey | QKNMLSCLKNMVIM-MSMCQVDSSA-N |
| XLogP | 7.11 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|