C25H16F6N2O2 — CID 91310683
N-(3-formyl-4-pyridinyl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 91310683) has the molecular formula C25H16F6N2O2 and a molecular weight of 490.40 g/mol. Its IUPAC name is N-(3-formyl-4-pyridinyl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | N-(3-formyl-4-pyridinyl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 91310683 |
| Molecular Formula | C25H16F6N2O2 |
| Molecular Weight | 490.40 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | N-(3-formyl-4-pyridinyl)-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | O=Cc1cnccc1NC(=O)C=CC=C(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H16F6N2O2/c26-24(27,28)19-8-4-16(5-9-19)21(17-6-10-20(11-7-17)25(29,30)31)2-1-3-23(35)33-22-12-13-32-14-18(22)15-34/h1-15H,(H,32,33,35) |
| InChIKey | SUYVTENLVJNZPV-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.40 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|