C30H21F6N3O — CID 86633258
(2E)-N-[2-(2-methylpyrimidin-4-yl)phenyl]-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 86633258) has the molecular formula C30H21F6N3O and a molecular weight of 553.51 g/mol. Its IUPAC name is (2E)-N-[2-(2-methylpyrimidin-4-yl)phenyl]-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | (2E)-N-[2-(2-methylpyrimidin-4-yl)phenyl]-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 86633258 |
| Molecular Formula | C30H21F6N3O |
| Molecular Weight | 553.51 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | (2E)-N-[2-(2-methylpyrimidin-4-yl)phenyl]-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | Cc1nccc(-c2ccccc2NC(=O)/C=C/C=C(c2ccc(C(F)(F)F)cc2)c2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C30H21F6N3O/c1-19-37-18-17-27(38-19)25-5-2-3-7-26(25)39-28(40)8-4-6-24(20-9-13-22(14-10-20)29(31,32)33)21-11-15-23(16-12-21)30(34,35)36/h2-18H,1H3,(H,39,40)/b8-4+ |
| InChIKey | YOLIZFNVOLKCEN-XBXARRHUSA-N |
| XLogP | 8.12 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.51 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|