C25H15F9N2O — CID 87598611
(2E)-5,5-bis[4-(trifluoromethyl)phenyl]-N-[5-(trifluoromethyl)-2-pyridinyl]penta-2,4-dienamide (PubChem CID 87598611) has the molecular formula C25H15F9N2O and a molecular weight of 530.39 g/mol. Its IUPAC name is (2E)-5,5-bis[4-(trifluoromethyl)phenyl]-N-[5-(trifluoromethyl)-2-pyridinyl]penta-2,4-dienamide.
| Compound Name | (2E)-5,5-bis[4-(trifluoromethyl)phenyl]-N-[5-(trifluoromethyl)-2-pyridinyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 87598611 |
| Molecular Formula | C25H15F9N2O |
| Molecular Weight | 530.39 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | (2E)-5,5-bis[4-(trifluoromethyl)phenyl]-N-[5-(trifluoromethyl)-2-pyridinyl]penta-2,4-dienamide |
| SMILES | O=C(/C=C/C=C(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)Nc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C25H15F9N2O/c26-23(27,28)17-8-4-15(5-9-17)20(16-6-10-18(11-7-16)24(29,30)31)2-1-3-22(37)36-21-13-12-19(14-35-21)25(32,33)34/h1-14H,(H,35,36,37)/b3-1+ |
| InChIKey | QQXMHEAIYZFPLA-HNQUOIGGSA-N |
| XLogP | 7.76 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.39 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|