C28H18F6N2O — CID 74423812
N-quinolin-7-yl-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide (PubChem CID 74423812) has the molecular formula C28H18F6N2O and a molecular weight of 512.45 g/mol. Its IUPAC name is N-quinolin-7-yl-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide.
| Compound Name | N-quinolin-7-yl-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
|---|---|
| PubChem CID | 74423812 |
| Molecular Formula | C28H18F6N2O |
| Molecular Weight | 512.45 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | N-quinolin-7-yl-5,5-bis[4-(trifluoromethyl)phenyl]penta-2,4-dienamide |
| SMILES | O=C(C=CC=C(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)Nc1ccc2cccnc2c1 |
| InChI | InChI=1S/C28H18F6N2O/c29-27(30,31)21-11-6-18(7-12-21)24(19-8-13-22(14-9-19)28(32,33)34)4-1-5-26(37)36-23-15-10-20-3-2-16-35-25(20)17-23/h1-17H,(H,36,37) |
| InChIKey | QKCMUOIQNXXYFB-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.45 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|