C21H16F3N3O — CID 67039113
N-quinolin-7-yl-2-[7-(trifluoromethyl)-2,3-dihydro-1H-quinolin-4-ylidene]acetamide (PubChem CID 67039113) has the molecular formula C21H16F3N3O and a molecular weight of 383.37 g/mol. Its IUPAC name is N-quinolin-7-yl-2-[7-(trifluoromethyl)-2,3-dihydro-1H-quinolin-4-ylidene]acetamide.
| Compound Name | N-quinolin-7-yl-2-[7-(trifluoromethyl)-2,3-dihydro-1H-quinolin-4-ylidene]acetamide |
|---|---|
| PubChem CID | 67039113 |
| Molecular Formula | C21H16F3N3O |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-quinolin-7-yl-2-[7-(trifluoromethyl)-2,3-dihydro-1H-quinolin-4-ylidene]acetamide |
| SMILES | O=C(C=C1CCNc2cc(C(F)(F)F)ccc21)Nc1ccc2cccnc2c1 |
| InChI | InChI=1S/C21H16F3N3O/c22-21(23,24)15-4-6-17-14(7-9-26-19(17)11-15)10-20(28)27-16-5-3-13-2-1-8-25-18(13)12-16/h1-6,8,10-12,26H,7,9H2,(H,27,28) |
| InChIKey | LRPGKBLCPCGRMH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|