C14H11N3O4 — CID 121232305
(2,5-dioxopyrrolidin-1-yl) N-quinolin-7-ylcarbamate (PubChem CID 121232305) has the molecular formula C14H11N3O4 and a molecular weight of 285.26 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) N-quinolin-7-ylcarbamate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) N-quinolin-7-ylcarbamate |
|---|---|
| PubChem CID | 121232305 |
| Molecular Formula | C14H11N3O4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) N-quinolin-7-ylcarbamate |
| SMILES | O=C(Nc1ccc2cccnc2c1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C14H11N3O4/c18-12-5-6-13(19)17(12)21-14(20)16-10-4-3-9-2-1-7-15-11(9)8-10/h1-4,7-8H,5-6H2,(H,16,20) |
| InChIKey | YZBBIYGSFYGFHE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|