About hydron;N-quinolin-7-ylformamide
hydron;N-quinolin-7-ylformamide (PubChem CID 174867438) has the molecular formula C10H9N2O+
and a molecular weight of 173.19 g/mol. Its IUPAC name is hydron;N-quinolin-7-ylformamide.
Molecular Properties
| Compound Name | hydron;N-quinolin-7-ylformamide |
| PubChem CID | 174867438 |
| Molecular Formula | C10H9N2O+ |
| Molecular Weight | 173.19 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | hydron;N-quinolin-7-ylformamide |
| SMILES | O=CNc1ccc2cccnc2c1.[H+] |
| InChI | InChI=1S/C10H8N2O/c13-7-12-9-4-3-8-2-1-5-11-10(8)6-9/h1-7H,(H,12,13)/p+1 |
| InChIKey | XTKLBSMTKSHTKN-UHFFFAOYSA-O |
| XLogP | 1.92 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.19 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze hydron;N-quinolin-7-ylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;N-quinolin-7-ylformamide?
The IUPAC name of hydron;N-quinolin-7-ylformamide (CID 174867438) is hydron;N-quinolin-7-ylformamide.
What is the SMILES notation for hydron;N-quinolin-7-ylformamide?
The canonical SMILES for hydron;N-quinolin-7-ylformamide is O=CNc1ccc2cccnc2c1.[H+].
What is the InChIKey of hydron;N-quinolin-7-ylformamide?
The InChIKey is XTKLBSMTKSHTKN-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H8N2O/c13-7-12-9-4-3-8-2-1-5-11-10(8)6-9/h1-7H,(H,12,13)/p+1.
What are the key properties of hydron;N-quinolin-7-ylformamide?
hydron;N-quinolin-7-ylformamide has a molecular weight of 173.19 g/mol, XLogP of 1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;N-quinolin-7-ylformamide is sourced from PubChem (CID 174867438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).