C16H22N2O — CID 156648097
ethane;N-quinolin-7-ylpentanamide (PubChem CID 156648097) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is ethane;N-quinolin-7-ylpentanamide.
| Compound Name | ethane;N-quinolin-7-ylpentanamide |
|---|---|
| PubChem CID | 156648097 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | ethane;N-quinolin-7-ylpentanamide |
| SMILES | CC.CCCCC(=O)Nc1ccc2cccnc2c1 |
| InChI | InChI=1S/C14H16N2O.C2H6/c1-2-3-6-14(17)16-12-8-7-11-5-4-9-15-13(11)10-12;1-2/h4-5,7-10H,2-3,6H2,1H3,(H,16,17);1-2H3 |
| InChIKey | WEURSRLRJAXOBW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |