About 7-isocyanatoquinoline
7-isocyanatoquinoline (PubChem CID 164643475) has the molecular formula C10H6N2O
and a molecular weight of 170.17 g/mol. Its IUPAC name is 7-isocyanatoquinoline.
Molecular Properties
| Compound Name | 7-isocyanatoquinoline |
| PubChem CID | 164643475 |
| Molecular Formula | C10H6N2O |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 7-isocyanatoquinoline |
| SMILES | O=C=Nc1ccc2cccnc2c1 |
| InChI | InChI=1S/C10H6N2O/c13-7-12-9-4-3-8-2-1-5-11-10(8)6-9/h1-6H |
| InChIKey | BQUBJWMIPASVFR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 7-isocyanatoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-isocyanatoquinoline?
The IUPAC name of 7-isocyanatoquinoline (CID 164643475) is 7-isocyanatoquinoline.
What is the SMILES notation for 7-isocyanatoquinoline?
The canonical SMILES for 7-isocyanatoquinoline is O=C=Nc1ccc2cccnc2c1.
What is the InChIKey of 7-isocyanatoquinoline?
The InChIKey is BQUBJWMIPASVFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2O/c13-7-12-9-4-3-8-2-1-5-11-10(8)6-9/h1-6H.
What are the key properties of 7-isocyanatoquinoline?
7-isocyanatoquinoline has a molecular weight of 170.17 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-isocyanatoquinoline is sourced from PubChem (CID 164643475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).