C7H3N3OS — CID 83383020
2-isocyanato-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 83383020) has the molecular formula C7H3N3OS and a molecular weight of 177.19 g/mol. Its IUPAC name is 2-isocyanato-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 2-isocyanato-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 83383020 |
| Molecular Formula | C7H3N3OS |
| Molecular Weight | 177.19 g/mol |
| Exact Mass | 177.00 |
| IUPAC Name | 2-isocyanato-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | O=C=Nc1nc2cccnc2s1 |
| InChI | InChI=1S/C7H3N3OS/c11-4-9-7-10-5-2-1-3-8-6(5)12-7/h1-3H |
| InChIKey | AOSIGBVCODJTAZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 55.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|