C6H3Cl2N3S — CID 89124498
N,N-dichloro-[1,3]thiazolo[5,4-b]pyridin-2-amine (PubChem CID 89124498) has the molecular formula C6H3Cl2N3S and a molecular weight of 220.08 g/mol. Its IUPAC name is N,N-dichloro-[1,3]thiazolo[5,4-b]pyridin-2-amine.
| Compound Name | N,N-dichloro-[1,3]thiazolo[5,4-b]pyridin-2-amine |
|---|---|
| PubChem CID | 89124498 |
| Molecular Formula | C6H3Cl2N3S |
| Molecular Weight | 220.08 g/mol |
| Exact Mass | 218.94 |
| IUPAC Name | N,N-dichloro-[1,3]thiazolo[5,4-b]pyridin-2-amine |
| SMILES | ClN(Cl)c1nc2cccnc2s1 |
| InChI | InChI=1S/C6H3Cl2N3S/c7-11(8)6-10-4-2-1-3-9-5(4)12-6/h1-3H |
| InChIKey | DGAQIQAAZAFXRV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.08 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|