About N,N-dichloro-[1,3]thiazolo[5,4-b]pyridin-2-amine
N,N-dichloro-[1,3]thiazolo[5,4-b]pyridin-2-amine (PubChem CID 89124498) has the molecular formula C6H3Cl2N3S
and a molecular weight of 220.08 g/mol. Its IUPAC name is N,N-dichloro-[1,3]thiazolo[5,4-b]pyridin-2-amine.
Molecular Properties
| Compound Name | N,N-dichloro-[1,3]thiazolo[5,4-b]pyridin-2-amine |
| PubChem CID | 89124498 |
| Molecular Formula | C6H3Cl2N3S |
| Molecular Weight | 220.08 g/mol |
| Exact Mass | 218.94 |
| IUPAC Name | N,N-dichloro-[1,3]thiazolo[5,4-b]pyridin-2-amine |
| SMILES | ClN(Cl)c1nc2cccnc2s1 |
| InChI | InChI=1S/C6H3Cl2N3S/c7-11(8)6-10-4-2-1-3-9-5(4)12-6/h1-3H |
| InChIKey | DGAQIQAAZAFXRV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.08 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N,N-dichloro-[1,3]thiazolo[5,4-b]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dichloro-[1,3]thiazolo[5,4-b]pyridin-2-amine?
The IUPAC name of N,N-dichloro-[1,3]thiazolo[5,4-b]pyridin-2-amine (CID 89124498) is N,N-dichloro-[1,3]thiazolo[5,4-b]pyridin-2-amine.
What is the SMILES notation for N,N-dichloro-[1,3]thiazolo[5,4-b]pyridin-2-amine?
The canonical SMILES for N,N-dichloro-[1,3]thiazolo[5,4-b]pyridin-2-amine is ClN(Cl)c1nc2cccnc2s1.
What is the InChIKey of N,N-dichloro-[1,3]thiazolo[5,4-b]pyridin-2-amine?
The InChIKey is DGAQIQAAZAFXRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl2N3S/c7-11(8)6-10-4-2-1-3-9-5(4)12-6/h1-3H.
What are the key properties of N,N-dichloro-[1,3]thiazolo[5,4-b]pyridin-2-amine?
N,N-dichloro-[1,3]thiazolo[5,4-b]pyridin-2-amine has a molecular weight of 220.08 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dichloro-[1,3]thiazolo[5,4-b]pyridin-2-amine is sourced from PubChem (CID 89124498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).