C10H14N2S — CID 160984221
methane;2-propan-2-yl-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 160984221) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is methane;2-propan-2-yl-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | methane;2-propan-2-yl-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 160984221 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | methane;2-propan-2-yl-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | C.CC(C)c1nc2cccnc2s1 |
| InChI | InChI=1S/C9H10N2S.CH4/c1-6(2)8-11-7-4-3-5-10-9(7)12-8;/h3-6H,1-2H3;1H4 |
| InChIKey | SZXHOTSMRQTOCP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |