C12H16N4S — CID 65335839
2-(1-piperazin-1-ylethyl)-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 65335839) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-(1-piperazin-1-ylethyl)-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 2-(1-piperazin-1-ylethyl)-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 65335839 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2-(1-piperazin-1-ylethyl)-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | CC(c1nc2cccnc2s1)N1CCNCC1 |
| InChI | InChI=1S/C12H16N4S/c1-9(16-7-5-13-6-8-16)11-15-10-3-2-4-14-12(10)17-11/h2-4,9,13H,5-8H2,1H3 |
| InChIKey | XZQABWLSCOUJEP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |