About 3-amino-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-ol
3-amino-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-ol (PubChem CID 65335836) has the molecular formula C9H11N3OS
and a molecular weight of 209.27 g/mol. Its IUPAC name is 3-amino-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-amino-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-ol |
| PubChem CID | 65335836 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 3-amino-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-ol |
| SMILES | NC(CCO)c1nc2cccnc2s1 |
| InChI | InChI=1S/C9H11N3OS/c10-6(3-5-13)8-12-7-2-1-4-11-9(7)14-8/h1-2,4,6,13H,3,5,10H2 |
| InChIKey | IBHNBCUCFSKNRI-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-ol?
The IUPAC name of 3-amino-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-ol (CID 65335836) is 3-amino-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-ol.
What is the SMILES notation for 3-amino-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-ol?
The canonical SMILES for 3-amino-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-ol is NC(CCO)c1nc2cccnc2s1.
What is the InChIKey of 3-amino-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-ol?
The InChIKey is IBHNBCUCFSKNRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3OS/c10-6(3-5-13)8-12-7-2-1-4-11-9(7)14-8/h1-2,4,6,13H,3,5,10H2.
What are the key properties of 3-amino-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-ol?
3-amino-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-ol has a molecular weight of 209.27 g/mol, XLogP of 1.07, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-([1,3]thiazolo[5,4-b]pyridin-2-yl)propan-1-ol is sourced from PubChem (CID 65335836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).