C8H14ClN3O — CID 171211346
(3R)-3-amino-3-(2-amino-3-pyridinyl)propan-1-ol;hydrochloride (PubChem CID 171211346) has the molecular formula C8H14ClN3O and a molecular weight of 203.67 g/mol. Its IUPAC name is (3R)-3-amino-3-(2-amino-3-pyridinyl)propan-1-ol;hydrochloride.
| Compound Name | (3R)-3-amino-3-(2-amino-3-pyridinyl)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171211346 |
| Molecular Formula | C8H14ClN3O |
| Molecular Weight | 203.67 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | (3R)-3-amino-3-(2-amino-3-pyridinyl)propan-1-ol;hydrochloride |
| SMILES | Cl.Nc1ncccc1[C@H](N)CCO |
| InChI | InChI=1S/C8H13N3O.ClH/c9-7(3-5-12)6-2-1-4-11-8(6)10;/h1-2,4,7,12H,3,5,9H2,(H2,10,11);1H/t7-;/m1./s1 |
| InChIKey | FJKKGKIUFJETIB-OGFXRTJISA-N |
| XLogP | 0.47 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.67 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |