C8H14N4 — CID 131122997
(1S,2S)-1-(2-amino-3-pyridinyl)propane-1,2-diamine (PubChem CID 131122997) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is (1S,2S)-1-(2-amino-3-pyridinyl)propane-1,2-diamine.
| Compound Name | (1S,2S)-1-(2-amino-3-pyridinyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 131122997 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | (1S,2S)-1-(2-amino-3-pyridinyl)propane-1,2-diamine |
| SMILES | C[C@H](N)[C@@H](N)c1cccnc1N |
| InChI | InChI=1S/C8H14N4/c1-5(9)7(10)6-3-2-4-12-8(6)11/h2-5,7H,9-10H2,1H3,(H2,11,12)/t5-,7+/m0/s1 |
| InChIKey | VCEVNLXSZLZOED-CAHLUQPWSA-N |
| XLogP | 0.01 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |