C9H15N3O2 — CID 79492532
3-(1-amino-2,2-dimethoxyethyl)pyridin-2-amine (PubChem CID 79492532) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 3-(1-amino-2,2-dimethoxyethyl)pyridin-2-amine.
| Compound Name | 3-(1-amino-2,2-dimethoxyethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 79492532 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 3-(1-amino-2,2-dimethoxyethyl)pyridin-2-amine |
| SMILES | COC(OC)C(N)c1cccnc1N |
| InChI | InChI=1S/C9H15N3O2/c1-13-9(14-2)7(10)6-4-3-5-12-8(6)11/h3-5,7,9H,10H2,1-2H3,(H2,11,12) |
| InChIKey | ZALLMJSRUXXWJU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|