About methoxymethane;3-methylpyridin-2-amine
methoxymethane;3-methylpyridin-2-amine (PubChem CID 142348172) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is methoxymethane;3-methylpyridin-2-amine.
Molecular Properties
| Compound Name | methoxymethane;3-methylpyridin-2-amine |
| PubChem CID | 142348172 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | methoxymethane;3-methylpyridin-2-amine |
| SMILES | COC.Cc1cccnc1N |
| InChI | InChI=1S/C6H8N2.C2H6O/c1-5-3-2-4-8-6(5)7;1-3-2/h2-4H,1H3,(H2,7,8);1-2H3 |
| InChIKey | FYXXQQLUWSIYMN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methoxymethane;3-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;3-methylpyridin-2-amine?
The IUPAC name of methoxymethane;3-methylpyridin-2-amine (CID 142348172) is methoxymethane;3-methylpyridin-2-amine.
What is the SMILES notation for methoxymethane;3-methylpyridin-2-amine?
The canonical SMILES for methoxymethane;3-methylpyridin-2-amine is COC.Cc1cccnc1N.
What is the InChIKey of methoxymethane;3-methylpyridin-2-amine?
The InChIKey is FYXXQQLUWSIYMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.C2H6O/c1-5-3-2-4-8-6(5)7;1-3-2/h2-4H,1H3,(H2,7,8);1-2H3.
What are the key properties of methoxymethane;3-methylpyridin-2-amine?
methoxymethane;3-methylpyridin-2-amine has a molecular weight of 154.21 g/mol, XLogP of 1.23, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;3-methylpyridin-2-amine is sourced from PubChem (CID 142348172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).