About 2-bromo-3-methylpyridine;zinc
2-bromo-3-methylpyridine;zinc (PubChem CID 87255964) has the molecular formula C6H6BrNZn
and a molecular weight of 237.41 g/mol. Its IUPAC name is 2-bromo-3-methylpyridine;zinc.
Molecular Properties
| Compound Name | 2-bromo-3-methylpyridine;zinc |
| PubChem CID | 87255964 |
| Molecular Formula | C6H6BrNZn |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 234.90 |
| IUPAC Name | 2-bromo-3-methylpyridine;zinc |
| SMILES | Cc1cccnc1Br.[Zn] |
| InChI | InChI=1S/C6H6BrN.Zn/c1-5-3-2-4-8-6(5)7;/h2-4H,1H3; |
| InChIKey | LLTZSZIWJJIMRF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3-methylpyridine;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3-methylpyridine;zinc?
The IUPAC name of 2-bromo-3-methylpyridine;zinc (CID 87255964) is 2-bromo-3-methylpyridine;zinc.
What is the SMILES notation for 2-bromo-3-methylpyridine;zinc?
The canonical SMILES for 2-bromo-3-methylpyridine;zinc is Cc1cccnc1Br.[Zn].
What is the InChIKey of 2-bromo-3-methylpyridine;zinc?
The InChIKey is LLTZSZIWJJIMRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrN.Zn/c1-5-3-2-4-8-6(5)7;/h2-4H,1H3;.
What are the key properties of 2-bromo-3-methylpyridine;zinc?
2-bromo-3-methylpyridine;zinc has a molecular weight of 237.41 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3-methylpyridine;zinc is sourced from PubChem (CID 87255964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).