C12H9Br2N — CID 155769988
2-(3,5-dibromophenyl)-3-methylpyridine (PubChem CID 155769988) has the molecular formula C12H9Br2N and a molecular weight of 327.02 g/mol. Its IUPAC name is 2-(3,5-dibromophenyl)-3-methylpyridine.
| Compound Name | 2-(3,5-dibromophenyl)-3-methylpyridine |
|---|---|
| PubChem CID | 155769988 |
| Molecular Formula | C12H9Br2N |
| Molecular Weight | 327.02 g/mol |
| Exact Mass | 324.91 |
| IUPAC Name | 2-(3,5-dibromophenyl)-3-methylpyridine |
| SMILES | Cc1cccnc1-c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C12H9Br2N/c1-8-3-2-4-15-12(8)9-5-10(13)7-11(14)6-9/h2-7H,1H3 |
| InChIKey | MEYBPHOXNQRATF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.02 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |