C12H9F2N — CID 142635597
2-(3,4-difluorophenyl)-3-methylpyridine (PubChem CID 142635597) has the molecular formula C12H9F2N and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-3-methylpyridine.
| Compound Name | 2-(3,4-difluorophenyl)-3-methylpyridine |
|---|---|
| PubChem CID | 142635597 |
| Molecular Formula | C12H9F2N |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-(3,4-difluorophenyl)-3-methylpyridine |
| SMILES | Cc1cccnc1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H9F2N/c1-8-3-2-6-15-12(8)9-4-5-10(13)11(14)7-9/h2-7H,1H3 |
| InChIKey | XYZFLESPLZWRGR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |