About ethane;3-methyl-2-phenylpyridine;pentane
ethane;3-methyl-2-phenylpyridine;pentane (PubChem CID 155691053) has the molecular formula C21H35N
and a molecular weight of 301.52 g/mol. Its IUPAC name is ethane;3-methyl-2-phenylpyridine;pentane.
Molecular Properties
| Compound Name | ethane;3-methyl-2-phenylpyridine;pentane |
| PubChem CID | 155691053 |
| Molecular Formula | C21H35N |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | ethane;3-methyl-2-phenylpyridine;pentane |
| SMILES | CC.CC.CCCCC.Cc1cccnc1-c1ccccc1 |
| InChI | InChI=1S/C12H11N.C5H12.2C2H6/c1-10-6-5-9-13-12(10)11-7-3-2-4-8-11;1-3-5-4-2;2*1-2/h2-9H,1H3;3-5H2,1-2H3;2*1-2H3 |
| InChIKey | MPYSLFXFXCZWBV-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;3-methyl-2-phenylpyridine;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methyl-2-phenylpyridine;pentane?
The IUPAC name of ethane;3-methyl-2-phenylpyridine;pentane (CID 155691053) is ethane;3-methyl-2-phenylpyridine;pentane.
What is the SMILES notation for ethane;3-methyl-2-phenylpyridine;pentane?
The canonical SMILES for ethane;3-methyl-2-phenylpyridine;pentane is CC.CC.CCCCC.Cc1cccnc1-c1ccccc1.
What is the InChIKey of ethane;3-methyl-2-phenylpyridine;pentane?
The InChIKey is MPYSLFXFXCZWBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.C5H12.2C2H6/c1-10-6-5-9-13-12(10)11-7-3-2-4-8-11;1-3-5-4-2;2*1-2/h2-9H,1H3;3-5H2,1-2H3;2*1-2H3.
What are the key properties of ethane;3-methyl-2-phenylpyridine;pentane?
ethane;3-methyl-2-phenylpyridine;pentane has a molecular weight of 301.52 g/mol, XLogP of 7.31, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methyl-2-phenylpyridine;pentane is sourced from PubChem (CID 155691053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).