C16H11Cl2N3 — CID 65430629
4,6-dichloro-2-(3-methyl-2-pyridinyl)-5-phenylpyrimidine (PubChem CID 65430629) has the molecular formula C16H11Cl2N3 and a molecular weight of 316.19 g/mol. Its IUPAC name is 4,6-dichloro-2-(3-methyl-2-pyridinyl)-5-phenylpyrimidine.
| Compound Name | 4,6-dichloro-2-(3-methyl-2-pyridinyl)-5-phenylpyrimidine |
|---|---|
| PubChem CID | 65430629 |
| Molecular Formula | C16H11Cl2N3 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 4,6-dichloro-2-(3-methyl-2-pyridinyl)-5-phenylpyrimidine |
| SMILES | Cc1cccnc1-c1nc(Cl)c(-c2ccccc2)c(Cl)n1 |
| InChI | InChI=1S/C16H11Cl2N3/c1-10-6-5-9-19-13(10)16-20-14(17)12(15(18)21-16)11-7-3-2-4-8-11/h2-9H,1H3 |
| InChIKey | FFGQSKFOUDATID-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |