C15H8Cl3N3 — CID 79432804
4,6-dichloro-5-(4-chlorophenyl)-2-pyridin-2-ylpyrimidine (PubChem CID 79432804) has the molecular formula C15H8Cl3N3 and a molecular weight of 336.61 g/mol. Its IUPAC name is 4,6-dichloro-5-(4-chlorophenyl)-2-pyridin-2-ylpyrimidine.
| Compound Name | 4,6-dichloro-5-(4-chlorophenyl)-2-pyridin-2-ylpyrimidine |
|---|---|
| PubChem CID | 79432804 |
| Molecular Formula | C15H8Cl3N3 |
| Molecular Weight | 336.61 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 4,6-dichloro-5-(4-chlorophenyl)-2-pyridin-2-ylpyrimidine |
| SMILES | Clc1ccc(-c2c(Cl)nc(-c3ccccn3)nc2Cl)cc1 |
| InChI | InChI=1S/C15H8Cl3N3/c16-10-6-4-9(5-7-10)12-13(17)20-15(21-14(12)18)11-3-1-2-8-19-11/h1-8H |
| InChIKey | WWNARTVORAEVTR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.61 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |