C14H9ClN4 — CID 14642993
5-chloro-6-phenyl-3-pyridin-2-yl-1,2,4-triazine (PubChem CID 14642993) has the molecular formula C14H9ClN4 and a molecular weight of 268.71 g/mol. Its IUPAC name is 5-chloro-6-phenyl-3-pyridin-2-yl-1,2,4-triazine.
| Compound Name | 5-chloro-6-phenyl-3-pyridin-2-yl-1,2,4-triazine |
|---|---|
| PubChem CID | 14642993 |
| Molecular Formula | C14H9ClN4 |
| Molecular Weight | 268.71 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 5-chloro-6-phenyl-3-pyridin-2-yl-1,2,4-triazine |
| SMILES | Clc1nc(-c2ccccn2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C14H9ClN4/c15-13-12(10-6-2-1-3-7-10)18-19-14(17-13)11-8-4-5-9-16-11/h1-9H |
| InChIKey | PBTQWNREAONKRA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.71 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |