C20H11F4N5 — CID 146048319
6-phenyl-3-pyridin-2-yl-N-(2,3,4,5-tetrafluorophenyl)-1,2,4-triazin-5-amine (PubChem CID 146048319) has the molecular formula C20H11F4N5 and a molecular weight of 397.34 g/mol. Its IUPAC name is 6-phenyl-3-pyridin-2-yl-N-(2,3,4,5-tetrafluorophenyl)-1,2,4-triazin-5-amine.
| Compound Name | 6-phenyl-3-pyridin-2-yl-N-(2,3,4,5-tetrafluorophenyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 146048319 |
| Molecular Formula | C20H11F4N5 |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 6-phenyl-3-pyridin-2-yl-N-(2,3,4,5-tetrafluorophenyl)-1,2,4-triazin-5-amine |
| SMILES | Fc1cc(Nc2nc(-c3ccccn3)nnc2-c2ccccc2)c(F)c(F)c1F |
| InChI | InChI=1S/C20H11F4N5/c21-12-10-14(16(23)17(24)15(12)22)26-20-18(11-6-2-1-3-7-11)28-29-19(27-20)13-8-4-5-9-25-13/h1-10H,(H,26,27,29) |
| InChIKey | VGNFHNVPLVTAIZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|