C14H7F2N5 — CID 172635167
7,8-difluoro-3-pyridin-2-yl-5H-[1,2,4]triazino[5,6-b]indole (PubChem CID 172635167) has the molecular formula C14H7F2N5 and a molecular weight of 283.24 g/mol. Its IUPAC name is 7,8-difluoro-3-pyridin-2-yl-5H-[1,2,4]triazino[5,6-b]indole.
| Compound Name | 7,8-difluoro-3-pyridin-2-yl-5H-[1,2,4]triazino[5,6-b]indole |
|---|---|
| PubChem CID | 172635167 |
| Molecular Formula | C14H7F2N5 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 7,8-difluoro-3-pyridin-2-yl-5H-[1,2,4]triazino[5,6-b]indole |
| SMILES | Fc1cc2[nH]c3nc(-c4ccccn4)nnc3c2cc1F |
| InChI | InChI=1S/C14H7F2N5/c15-8-5-7-11(6-9(8)16)18-14-12(7)20-21-13(19-14)10-3-1-2-4-17-10/h1-6H,(H,18,19,21) |
| InChIKey | VNWWIUKHNXFIFA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |