About CID 139150015
CID 139150015 (PubChem CID 139150015) has the molecular formula C36H24KN12
and a molecular weight of 663.77 g/mol.
Molecular Properties
| Compound Name | CID 139150015 |
| PubChem CID | 139150015 |
| Molecular Formula | C36H24KN12 |
| Molecular Weight | 663.77 g/mol |
| Exact Mass | 663.19 |
| IUPAC Name | — |
| SMILES | [K].c1ccc(-c2nc(-c3ccccn3)nc(-c3ccccn3)n2)nc1.c1ccc(-c2nc(-c3ccccn3)nc(-c3ccccn3)n2)nc1 |
| InChI | InChI=1S/2C18H12N6.K/c2*1-4-10-19-13(7-1)16-22-17(14-8-2-5-11-20-14)24-18(23-16)15-9-3-6-12-21-15;/h2*1-12H; |
| InChIKey | OQKWKBYEVPMPEK-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 154.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 663.77 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Analyze CID 139150015 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139150015?
The IUPAC name of CID 139150015 (CID 139150015) is not available.
What is the SMILES notation for CID 139150015?
The canonical SMILES for CID 139150015 is [K].c1ccc(-c2nc(-c3ccccn3)nc(-c3ccccn3)n2)nc1.c1ccc(-c2nc(-c3ccccn3)nc(-c3ccccn3)n2)nc1.
What is the InChIKey of CID 139150015?
The InChIKey is OQKWKBYEVPMPEK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C18H12N6.K/c2*1-4-10-19-13(7-1)16-22-17(14-8-2-5-11-20-14)24-18(23-16)15-9-3-6-12-21-15;/h2*1-12H;.
What are the key properties of CID 139150015?
CID 139150015 has a molecular weight of 663.77 g/mol, XLogP of 5.73, 6 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139150015 is sourced from PubChem (CID 139150015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).