C19H14N6 — CID 58261693
2-(5-methyl-2-pyridinyl)-4,6-dipyridin-2-yl-1,3,5-triazine (PubChem CID 58261693) has the molecular formula C19H14N6 and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-(5-methyl-2-pyridinyl)-4,6-dipyridin-2-yl-1,3,5-triazine.
| Compound Name | 2-(5-methyl-2-pyridinyl)-4,6-dipyridin-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 58261693 |
| Molecular Formula | C19H14N6 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-(5-methyl-2-pyridinyl)-4,6-dipyridin-2-yl-1,3,5-triazine |
| SMILES | Cc1ccc(-c2nc(-c3ccccn3)nc(-c3ccccn3)n2)nc1 |
| InChI | InChI=1S/C19H14N6/c1-13-8-9-16(22-12-13)19-24-17(14-6-2-4-10-20-14)23-18(25-19)15-7-3-5-11-21-15/h2-12H,1H3 |
| InChIKey | GSIVNMVBARBKFX-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |