C17H13BrN2Pt — CID 58637296
bromoplatinum(1+);5-methyl-2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine (PubChem CID 58637296) has the molecular formula C17H13BrN2Pt and a molecular weight of 520.29 g/mol. Its IUPAC name is bromoplatinum(1+);5-methyl-2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine.
| Compound Name | bromoplatinum(1+);5-methyl-2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine |
|---|---|
| PubChem CID | 58637296 |
| Molecular Formula | C17H13BrN2Pt |
| Molecular Weight | 520.29 g/mol |
| Exact Mass | 518.99 |
| IUPAC Name | bromoplatinum(1+);5-methyl-2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine |
| SMILES | Br[Pt+].Cc1ccc(-c2[c-]c(-c3ccccn3)ccc2)nc1 |
| InChI | InChI=1S/C17H13N2.BrH.Pt/c1-13-8-9-17(19-12-13)15-6-4-5-14(11-15)16-7-2-3-10-18-16;;/h2-10,12H,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | OPRGQRIIWUOUGR-UHFFFAOYSA-M |
| XLogP | 4.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.29 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|