C24H16N2Pt — CID 21024826
ethynylbenzene;platinum(2+);2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine (PubChem CID 21024826) has the molecular formula C24H16N2Pt and a molecular weight of 527.48 g/mol. Its IUPAC name is ethynylbenzene;platinum(2+);2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine.
| Compound Name | ethynylbenzene;platinum(2+);2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine |
|---|---|
| PubChem CID | 21024826 |
| Molecular Formula | C24H16N2Pt |
| Molecular Weight | 527.48 g/mol |
| Exact Mass | 527.10 |
| IUPAC Name | ethynylbenzene;platinum(2+);2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine |
| SMILES | [C-]#Cc1ccccc1.[Pt+2].[c-]1c(-c2ccccn2)cccc1-c1ccccn1 |
| InChI | InChI=1S/C16H11N2.C8H5.Pt/c1-3-10-17-15(8-1)13-6-5-7-14(12-13)16-9-2-4-11-18-16;1-2-8-6-4-3-5-7-8;/h1-11H;3-7H;/q2*-1;+2 |
| InChIKey | AYTZREQGVHNEBS-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|