C35H27N3Pt — CID 158290234
methane;N-(2-phenylphenyl)-3-pyridin-2-yl-N-(3-pyridin-2-ylbenzene-2-id-1-yl)benzene-2-id-1-amine;platinum(2+) (PubChem CID 158290234) has the molecular formula C35H27N3Pt and a molecular weight of 684.70 g/mol. Its IUPAC name is methane;N-(2-phenylphenyl)-3-pyridin-2-yl-N-(3-pyridin-2-ylbenzene-2-id-1-yl)benzene-2-id-1-amine;platinum(2+).
| Compound Name | methane;N-(2-phenylphenyl)-3-pyridin-2-yl-N-(3-pyridin-2-ylbenzene-2-id-1-yl)benzene-2-id-1-amine;platinum(2+) |
|---|---|
| PubChem CID | 158290234 |
| Molecular Formula | C35H27N3Pt |
| Molecular Weight | 684.70 g/mol |
| Exact Mass | 684.19 |
| IUPAC Name | methane;N-(2-phenylphenyl)-3-pyridin-2-yl-N-(3-pyridin-2-ylbenzene-2-id-1-yl)benzene-2-id-1-amine;platinum(2+) |
| SMILES | C.[Pt+2].[c-]1c(-c2ccccn2)cccc1N(c1[c-]c(-c2ccccn2)ccc1)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C34H23N3.CH4.Pt/c1-2-12-26(13-3-1)31-18-4-5-21-34(31)37(29-16-10-14-27(24-29)32-19-6-8-22-35-32)30-17-11-15-28(25-30)33-20-7-9-23-36-33;;/h1-23H;1H4;/q-2;;+2 |
| InChIKey | DYAHVBVCEYEWEV-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.70 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|