C46H36N4Pt — CID 154595157
platinum(2+);8,8,14,14-tetramethyl-N,N-bis(3-pyridin-2-ylbenzene-2-id-1-yl)-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-amine (PubChem CID 154595157) has the molecular formula C46H36N4Pt and a molecular weight of 839.90 g/mol. Its IUPAC name is platinum(2+);8,8,14,14-tetramethyl-N,N-bis(3-pyridin-2-ylbenzene-2-id-1-yl)-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-amine.
| Compound Name | platinum(2+);8,8,14,14-tetramethyl-N,N-bis(3-pyridin-2-ylbenzene-2-id-1-yl)-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-amine |
|---|---|
| PubChem CID | 154595157 |
| Molecular Formula | C46H36N4Pt |
| Molecular Weight | 839.90 g/mol |
| Exact Mass | 839.26 |
| IUPAC Name | platinum(2+);8,8,14,14-tetramethyl-N,N-bis(3-pyridin-2-ylbenzene-2-id-1-yl)-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9,11,13(21),15,17,19-nonaen-11-amine |
| SMILES | CC1(C)c2ccccc2N2c3ccccc3C(C)(C)c3cc(N(c4[c-]c(-c5ccccn5)ccc4)c4[c-]c(-c5ccccn5)ccc4)cc1c32.[Pt+2] |
| InChI | InChI=1S/C46H36N4.Pt/c1-45(2)36-19-5-7-23-42(36)50-43-24-8-6-20-37(43)46(3,4)39-30-35(29-38(45)44(39)50)49(33-17-13-15-31(27-33)40-21-9-11-25-47-40)34-18-14-16-32(28-34)41-22-10-12-26-48-41;/h5-26,29-30H,1-4H3;/q-2;+2 |
| InChIKey | DBRVIAQMCKQXSY-UHFFFAOYSA-N |
| XLogP | 11.63 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.90 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|