C74H54N8Pt — CID 162118924
CID 162118924 (PubChem CID 162118924) has the molecular formula C74H54N8Pt and a molecular weight of 1250.38 g/mol.
| Compound Name | CID 162118924 |
|---|---|
| PubChem CID | 162118924 |
| Molecular Formula | C74H54N8Pt |
| Molecular Weight | 1250.38 g/mol |
| Exact Mass | 1249.41 |
| IUPAC Name | — |
| SMILES | CC1(C)c2cc3c4ccccc4n(-c4ccccn4)c3[c-]c2N(c2[c-]c(-c3ccccn3)ccc2)c2ccccc21.CC1(C)c2ccccc2N(c2cccc(-c3ccccn3)c2)c2cc3c(cc21)c1ccccc1n3-c1ccccn1.[Pt+2] |
| InChI | InChI=1S/C37H28N4.C37H26N4.Pt/c2*1-37(2)29-15-4-6-18-33(29)40(26-13-11-12-25(22-26)31-16-7-9-20-38-31)35-24-34-28(23-30(35)37)27-14-3-5-17-32(27)41(34)36-19-8-10-21-39-36;/h3-24H,1-2H3;3-21,23H,1-2H3;/q;-2;+2 |
| InChIKey | BXQZHDWLNQODJZ-UHFFFAOYSA-N |
| XLogP | 18.30 |
| TPSA | 67.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1250.38 |
| LogP ≤ 5 | 18.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|