C55H49N5PtS — CID 170935368
CID 170935368 (PubChem CID 170935368) has the molecular formula C55H49N5PtS and a molecular weight of 1007.18 g/mol.
| Compound Name | CID 170935368 |
|---|---|
| PubChem CID | 170935368 |
| Molecular Formula | C55H49N5PtS |
| Molecular Weight | 1007.18 g/mol |
| Exact Mass | 1006.34 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c4c(cc3c3ccccc32)C(C)(C)c2ccccc2N4c2[c-]c(C3=N[C@@H]4Cc5c(cccc5C(C)(C)C)[C@@H]4S3)cc(-c3ccccn3)c2)c1.[Pt+2] |
| InChI | InChI=1S/C55H49N5S.Pt/c1-53(2,3)35-23-25-57-50(29-35)60-46-21-11-9-16-37(46)40-30-43-49(32-48(40)60)59(47-22-12-10-18-42(47)55(43,7)8)36-27-33(44-20-13-14-24-56-44)26-34(28-36)52-58-45-31-39-38(51(45)61-52)17-15-19-41(39)54(4,5)6;/h9-27,29-30,45,51H,31H2,1-8H3;/q-2;+2/t45-,51+;/m1./s1 |
| InChIKey | XCBCLTXEWBSFJK-XYKRKMICSA-N |
| XLogP | 13.70 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1007.18 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|