C68H69N5Pt — CID 170932891
CID 170932891 (PubChem CID 170932891) has the molecular formula C68H69N5Pt and a molecular weight of 1151.41 g/mol.
| Compound Name | CID 170932891 |
|---|---|
| PubChem CID | 170932891 |
| Molecular Formula | C68H69N5Pt |
| Molecular Weight | 1151.41 g/mol |
| Exact Mass | 1150.52 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1)c1cc3c([c-]c1n2-c1cc(C(C)(C)C)ccn1)N(c1[c-]c(C2=N[C@H](C(c4ccccc4)c4ccccc4)CN2c2c(C(C)C)cccc2C(C)C)cc(C(C)C)c1)c1ccccc1C3(C)C.[Pt+2] |
| InChI | InChI=1S/C68H69N5.Pt/c1-42(2)48-35-49(66-70-58(64(46-22-15-13-16-23-46)47-24-17-14-18-25-47)41-71(66)65-52(43(3)4)26-21-27-53(65)44(5)6)37-51(36-48)72-60-29-20-19-28-56(60)68(11,12)57-39-55-54-34-45(7)30-31-59(54)73(61(55)40-62(57)72)63-38-50(32-33-69-63)67(8,9)10;/h13-36,38-39,42-44,58,64H,41H2,1-12H3;/q-2;+2/t58-;/m0./s1 |
| InChIKey | XHZBNGZARWPWCD-FEJMEUATSA-N |
| XLogP | 17.33 |
| TPSA | 36.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1151.41 |
| LogP ≤ 5 | 17.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|