C54H46N4OPt — CID 170935591
CID 170935591 (PubChem CID 170935591) has the molecular formula C54H46N4OPt and a molecular weight of 962.07 g/mol.
| Compound Name | CID 170935591 |
|---|---|
| PubChem CID | 170935591 |
| Molecular Formula | C54H46N4OPt |
| Molecular Weight | 962.07 g/mol |
| Exact Mass | 961.33 |
| IUPAC Name | — |
| SMILES | Cc1cc(C2=N[C@@H]3c4ccc(C)cc4-c4cc(C)ccc4[C@@H]3O2)[c-]c(N2c3[c-]c4c(cc3C(C)(C)c3ccccc32)c2ccccc2n4-c2cc(C(C)(C)C)ccn2)c1.[Pt+2] |
| InChI | InChI=1S/C54H46N4O.Pt/c1-31-17-19-38-40(25-31)41-26-32(2)18-20-39(41)51-50(38)56-52(59-51)34-23-33(3)24-36(27-34)57-46-16-12-10-14-43(46)54(7,8)44-29-42-37-13-9-11-15-45(37)58(47(42)30-48(44)57)49-28-35(21-22-55-49)53(4,5)6;/h9-26,28-29,50-51H,1-8H3;/q-2;+2/t50-,51+;/m1./s1 |
| InChIKey | LGVGIFQEIAWYJF-ZILCTCJPSA-N |
| XLogP | 13.35 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 962.07 |
| LogP ≤ 5 | 13.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|