C57H54N4OPt — CID 170935038
CID 170935038 (PubChem CID 170935038) has the molecular formula C57H54N4OPt and a molecular weight of 1006.16 g/mol.
| Compound Name | CID 170935038 |
|---|---|
| PubChem CID | 170935038 |
| Molecular Formula | C57H54N4OPt |
| Molecular Weight | 1006.16 g/mol |
| Exact Mass | 1005.39 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc3c4cc(C)ccc4n(-c4cc(C(C)(C)C)ccn4)c3[c-]c1N2c1[c-]c(C2=N[C@H](c3ccccc3)[C@@H](c3ccccc3)O2)cc(C(C)(C)C)c1.[Pt+2] |
| InChI | InChI=1S/C57H54N4O.Pt/c1-35-21-23-47-43(27-35)44-33-46-50(34-49(44)61(47)51-32-40(25-26-58-51)55(3,4)5)60(48-24-22-36(2)28-45(48)57(46,9)10)42-30-39(29-41(31-42)56(6,7)8)54-59-52(37-17-13-11-14-18-37)53(62-54)38-19-15-12-16-20-38;/h11-29,31-33,52-53H,1-10H3;/q-2;+2/t52-,53-;/m1./s1 |
| InChIKey | PFPUCHGAZRUOTO-WWQJKYSCSA-N |
| XLogP | 14.36 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1006.16 |
| LogP ≤ 5 | 14.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|