C56H58N4O2Pt — CID 170935013
CID 170935013 (PubChem CID 170935013) has the molecular formula C56H58N4O2Pt and a molecular weight of 1016.20 g/mol.
| Compound Name | CID 170935013 |
|---|---|
| PubChem CID | 170935013 |
| Molecular Formula | C56H58N4O2Pt |
| Molecular Weight | 1016.20 g/mol |
| Exact Mass | 1015.43 |
| IUPAC Name | — |
| SMILES | [2H]C1([2H])c2cc(C)c(C)cc2[C@@]2(C)N=C(c3[c-]c(N4c5[c-]c6c(cc5Oc5cc(C)ccc54)c4cc(C)ccc4n6-c4cc(C(C)(C)C)ccn4)cc(C(C)(C)C)c3)O[C@@]12C(C)(C)C.[Pt+2] |
| InChI | InChI=1S/C56H58N4O2.Pt/c1-32-15-17-44-41(21-32)42-29-49-47(30-46(42)60(44)50-28-38(19-20-57-50)52(5,6)7)59(45-18-16-33(2)22-48(45)61-49)40-26-36(25-39(27-40)53(8,9)10)51-58-55(14)43-24-35(4)34(3)23-37(43)31-56(55,62-51)54(11,12)13;/h15-25,27-29H,31H2,1-14H3;/q-2;+2/t55-,56-;/m1./s1/i31D2; |
| InChIKey | AVGFNRJSDRPOTI-WLOCUXHCSA-N |
| XLogP | 14.21 |
| TPSA | 51.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1016.20 |
| LogP ≤ 5 | 14.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|