C56H50N4OPt — CID 170935756
CID 170935756 (PubChem CID 170935756) has the molecular formula C56H50N4OPt and a molecular weight of 990.12 g/mol.
| Compound Name | CID 170935756 |
|---|---|
| PubChem CID | 170935756 |
| Molecular Formula | C56H50N4OPt |
| Molecular Weight | 990.12 g/mol |
| Exact Mass | 989.36 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c4c(cc3c3ccccc32)C(C)(C)c2ccccc2N4c2[c-]c(C3=N[C@]4(C)C(C)(C)c5ccccc5[C@]4(C)O3)cc(-c3ccccc3)c2)c1.[Pt+2] |
| InChI | InChI=1S/C56H50N4O.Pt/c1-52(2,3)38-27-28-57-50(32-38)60-46-25-17-13-21-40(46)41-33-45-49(34-48(41)60)59(47-26-18-16-24-44(47)53(45,4)5)39-30-36(35-19-11-10-12-20-35)29-37(31-39)51-58-56(9)54(6,7)42-22-14-15-23-43(42)55(56,8)61-51;/h10-30,32-33H,1-9H3;/q-2;+2/t55-,56+;/m0./s1 |
| InChIKey | KQLOVENJPPEJJH-AFZHLTNFSA-N |
| XLogP | 13.59 |
| TPSA | 42.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 990.12 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|