C48H45N3O2Pt — CID 170932874
(4R,5R)-2-[3-[[10-(4-tert-butyl-2-pyridinyl)-9,9-dimethyl-4H-acridin-4-id-3-yl]oxy]-5-propan-2-ylbenzene-2-id-1-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole;platinum(2+) (PubChem CID 170932874) has the molecular formula C48H45N3O2Pt and a molecular weight of 890.99 g/mol. Its IUPAC name is (4R,5R)-2-[3-[[10-(4-tert-butyl-2-pyridinyl)-9,9-dimethyl-4H-acridin-4-id-3-yl]oxy]-5-propan-2-ylbenzene-2-id-1-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole;platinum(2+).
| Compound Name | (4R,5R)-2-[3-[[10-(4-tert-butyl-2-pyridinyl)-9,9-dimethyl-4H-acridin-4-id-3-yl]oxy]-5-propan-2-ylbenzene-2-id-1-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole;platinum(2+) |
|---|---|
| PubChem CID | 170932874 |
| Molecular Formula | C48H45N3O2Pt |
| Molecular Weight | 890.99 g/mol |
| Exact Mass | 890.32 |
| IUPAC Name | (4R,5R)-2-[3-[[10-(4-tert-butyl-2-pyridinyl)-9,9-dimethyl-4H-acridin-4-id-3-yl]oxy]-5-propan-2-ylbenzene-2-id-1-yl]-4,5-diphenyl-4,5-dihydro-1,3-oxazole;platinum(2+) |
| SMILES | CC(C)c1cc(Oc2[c-]c3c(cc2)C(C)(C)c2ccccc2N3c2cc(C(C)(C)C)ccn2)[c-]c(C2=N[C@H](c3ccccc3)[C@@H](c3ccccc3)O2)c1.[Pt+2] |
| InChI | InChI=1S/C48H45N3O2.Pt/c1-31(2)34-26-35(46-50-44(32-16-10-8-11-17-32)45(53-46)33-18-12-9-13-19-33)28-38(27-34)52-37-22-23-40-42(30-37)51(41-21-15-14-20-39(41)48(40,6)7)43-29-36(24-25-49-43)47(3,4)5;/h8-27,29,31,44-45H,1-7H3;/q-2;+2/t44-,45-;/m1./s1 |
| InChIKey | GMBDKJGETAULTG-DINRFCRBSA-N |
| XLogP | 12.26 |
| TPSA | 46.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 890.99 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|